From 702def10b0de928bf4b890add03d546ce8953ed8 Mon Sep 17 00:00:00 2001 From: mite-bot Date: Mon, 29 Dec 2025 19:38:19 +0000 Subject: [PATCH] Contributor submission NosL --- .../0e0c24a4-e4eb-11f0-abdb-8218ec668ab3.json | 69 +++++++++++++++++++ 1 file changed, 69 insertions(+) create mode 100644 mite_data/data/0e0c24a4-e4eb-11f0-abdb-8218ec668ab3.json diff --git a/mite_data/data/0e0c24a4-e4eb-11f0-abdb-8218ec668ab3.json b/mite_data/data/0e0c24a4-e4eb-11f0-abdb-8218ec668ab3.json new file mode 100644 index 0000000..8b21501 --- /dev/null +++ b/mite_data/data/0e0c24a4-e4eb-11f0-abdb-8218ec668ab3.json @@ -0,0 +1,69 @@ +{ + "accession": "MITE9999999", + "status": "pending", + "changelog": [ + { + "version": "1", + "date": "2025-12-29", + "contributors": [ + "AAAAAAAAAAAAAAAAAAAAAAAA" + ], + "reviewers": [ + "BBBBBBBBBBBBBBBBBBBBBBBB" + ], + "comment": "New entry." + } + ], + "enzyme": { + "name": "NosL", + "description": "Radical SAM enzyme", + "references": [ + "doi:10.1021/cb900133x", + "doi:10.1038/nchembio.512" + ], + "databaseIds": { + "uniprot": "C6FX51", + "genpept": "ACR48341.1", + "mibig": "BGC0000610" + }, + "cofactors": { + "organic": [ + "SAM" + ], + "inorganic": [ + "FeS" + ] + } + }, + "reactions": [ + { + "tailoring": [ + "Carboxylation", + "Deamination", + "Decarboxylation" + ], + "description": "3-methyl-2-indolic acid (MIA) synthase involved in nosiheptide biosynthesis", + "reactionSMARTS": "[#7:1]\\[#6@:2](-[#6:13](-[#8:15])=[#8:14])-[#6:3]-[#6:4]1:[#6:8]2:[#6:9]:[#6:10]:[#6:11]:[#6:12]:[#6:7]:2:[#7:6]:[#6:5]:1>>[#6:3]-[#6:4]1:[#6:8]2:[#6:9]:[#6:10]:[#6:11]:[#6:12]:[#6:7]:2:[#7:6]:[#6:5]:1-[#6:13](-[#8:15])=[#8:14]", + "reactions": [ + { + "substrate": "N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O", + "products": [ + "Cc1c(C(=O)O)[nH]c2ccccc12" + ], + "isIntermediate": true, + "description": "Removal of the Ca-N unit of L-tryptophan and shift of carboxylate to the indole ring." + } + ], + "evidence": { + "evidenceCode": [ + "In vitro assay", + "Knock-out studies", + "Site-directed mutagenesis" + ], + "references": [ + "doi:10.1038/nchembio.512" + ] + } + } + ] +} \ No newline at end of file